C8Br2F16O2 — CID 14150202
1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane (PubChem CID 14150202) has the molecular formula C8Br2F16O2 and a molecular weight of 591.86 g/mol. Its IUPAC name is 1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane.
| Compound Name | 1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane |
|---|---|
| PubChem CID | 14150202 |
| Molecular Formula | C8Br2F16O2 |
| Molecular Weight | 591.86 g/mol |
| Exact Mass | 589.80 |
| IUPAC Name | 1-(1,2-dibromo-1,2,2-trifluoroethoxy)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(F)(Br)C(F)(F)Br |
| InChI | InChI=1S/C8Br2F16O2/c9-3(14,15)4(10,16)28-8(25,26)2(13,6(20,21)22)27-7(23,24)1(11,12)5(17,18)19 |
| InChIKey | HMHOHHNZGMYVFY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.86 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|