C17F34O5 — CID 22750746
1,1,1,2,4,5,5,5-octafluoro-2,4-bis[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]pentan-3-one (PubChem CID 22750746) has the molecular formula C17F34O5 and a molecular weight of 930.11 g/mol. Its IUPAC name is 1,1,1,2,4,5,5,5-octafluoro-2,4-bis[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]pentan-3-one.
| Compound Name | 1,1,1,2,4,5,5,5-octafluoro-2,4-bis[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]pentan-3-one |
|---|---|
| PubChem CID | 22750746 |
| Molecular Formula | C17F34O5 |
| Molecular Weight | 930.11 g/mol |
| Exact Mass | 929.92 |
| IUPAC Name | 1,1,1,2,4,5,5,5-octafluoro-2,4-bis[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]pentan-3-one |
| SMILES | O=C(C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17F34O5/c18-2(8(26,27)28,53-16(48,49)6(24,12(38,39)40)55-14(44,45)4(20,21)10(32,33)34)1(52)3(19,9(29,30)31)54-17(50,51)7(25,13(41,42)43)56-15(46,47)5(22,23)11(35,36)37 |
| InChIKey | DTZBWSNROLAEIW-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.11 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|