C14HF26NaO6 — CID 175521242
sodium;hydride;[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl] 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,2-pentafluoroethoxy)propoxy]propanoate (PubChem CID 175521242) has the molecular formula C14HF26NaO6 and a molecular weight of 782.09 g/mol. Its IUPAC name is sodium;hydride;[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl] 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,2-pentafluoroethoxy)propoxy]propanoate.
| Compound Name | sodium;hydride;[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl] 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,2-pentafluoroethoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 175521242 |
| Molecular Formula | C14HF26NaO6 |
| Molecular Weight | 782.09 g/mol |
| Exact Mass | 781.93 |
| IUPAC Name | sodium;hydride;[2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoyl] 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,2-pentafluoroethoxy)propoxy]propanoate |
| SMILES | O=C(OC(=O)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C14F26O6.Na.H/c15-3(7(20,21)22,44-12(35,36)5(17,18)9(26,27)28)1(41)43-2(42)4(16,8(23,24)25)45-13(37,38)6(19,10(29,30)31)46-14(39,40)11(32,33)34;;/q;+1;-1 |
| InChIKey | ATMJCYZPTSDXTD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.09 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|