C15H13F17O4 — CID 162812992
[(2R)-3,3-dimethylbutan-2-yl] (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate (PubChem CID 162812992) has the molecular formula C15H13F17O4 and a molecular weight of 580.23 g/mol. Its IUPAC name is [(2R)-3,3-dimethylbutan-2-yl] (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate.
| Compound Name | [(2R)-3,3-dimethylbutan-2-yl] (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 162812992 |
| Molecular Formula | C15H13F17O4 |
| Molecular Weight | 580.23 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | [(2R)-3,3-dimethylbutan-2-yl] (2R)-2,3,3,3-tetrafluoro-2-[(2R)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoate |
| SMILES | C[C@@H](OC(=O)[C@](F)(OC(F)(F)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C15H13F17O4/c1-5(7(2,3)4)34-6(33)8(16,11(20,21)22)35-15(31,32)10(19,13(26,27)28)36-14(29,30)9(17,18)12(23,24)25/h5H,1-4H3/t5-,8+,10-/m1/s1 |
| InChIKey | JXPUKRLBUAVXEM-CPBLVBHUSA-N |
| XLogP | 6.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.23 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|