C12H13F11O3 — CID 71673102
3,3-dimethylbutan-2-yl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 71673102) has the molecular formula C12H13F11O3 and a molecular weight of 414.21 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | 3,3-dimethylbutan-2-yl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 71673102 |
| Molecular Formula | C12H13F11O3 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3,3-dimethylbutan-2-yl 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | CC(OC(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H13F11O3/c1-5(7(2,3)4)25-6(24)8(13,10(16,17)18)26-12(22,23)9(14,15)11(19,20)21/h5H,1-4H3 |
| InChIKey | UAEUEGWJLABTNU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|