C10H9F11O3 — CID 162813297
[(2R)-butan-2-yl] (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 162813297) has the molecular formula C10H9F11O3 and a molecular weight of 386.16 g/mol. Its IUPAC name is [(2R)-butan-2-yl] (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | [(2R)-butan-2-yl] (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 162813297 |
| Molecular Formula | C10H9F11O3 |
| Molecular Weight | 386.16 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | [(2R)-butan-2-yl] (2S)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | CC[C@@H](C)OC(=O)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F11O3/c1-3-4(2)23-5(22)6(11,8(14,15)16)24-10(20,21)7(12,13)9(17,18)19/h4H,3H2,1-2H3/t4-,6-/m1/s1 |
| InChIKey | UJKLXHUBMDNJOB-INEUFUBQSA-N |
| XLogP | 4.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|