C15H14F17NO3 — CID 162807478
(2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-di(propan-2-yl)propanamide (PubChem CID 162807478) has the molecular formula C15H14F17NO3 and a molecular weight of 579.25 g/mol. Its IUPAC name is (2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 162807478 |
| Molecular Formula | C15H14F17NO3 |
| Molecular Weight | 579.25 g/mol |
| Exact Mass | 579.07 |
| IUPAC Name | (2S)-2,3,3,3-tetrafluoro-2-[(2S)-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)[C@@](F)(OC(F)(F)[C@@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C15H14F17NO3/c1-5(2)33(6(3)4)7(34)8(16,11(20,21)22)35-15(31,32)10(19,13(26,27)28)36-14(29,30)9(17,18)12(23,24)25/h5-6H,1-4H3/t8-,10+/m1/s1 |
| InChIKey | JBEXECVIKBJVPZ-SCZZXKLOSA-N |
| XLogP | 6.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.25 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|