C8H6F11NO2 — CID 71672279
2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dimethylpropanamide (PubChem CID 71672279) has the molecular formula C8H6F11NO2 and a molecular weight of 357.12 g/mol. Its IUPAC name is 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dimethylpropanamide.
| Compound Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 71672279 |
| Molecular Formula | C8H6F11NO2 |
| Molecular Weight | 357.12 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H6F11NO2/c1-20(2)3(21)4(9,6(12,13)14)22-8(18,19)5(10,11)7(15,16)17/h1-2H3 |
| InChIKey | XVAKBWPSNQBMFA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|