C7H4F11NO2 — CID 162854102
(2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide (PubChem CID 162854102) has the molecular formula C7H4F11NO2 and a molecular weight of 343.09 g/mol. Its IUPAC name is (2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide.
| Compound Name | (2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 162854102 |
| Molecular Formula | C7H4F11NO2 |
| Molecular Weight | 343.09 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | (2R)-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-N-methylpropanamide |
| SMILES | CNC(=O)[C@](F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H4F11NO2/c1-19-2(20)3(8,5(11,12)13)21-7(17,18)4(9,10)6(14,15)16/h1H3,(H,19,20)/t3-/m0/s1 |
| InChIKey | SNFWFDWHBNJEGA-VKHMYHEASA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|