C6H4F11NO3 — CID 51342034
azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate (PubChem CID 51342034) has the molecular formula C6H4F11NO3 and a molecular weight of 347.08 g/mol. Its IUPAC name is azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate.
| Compound Name | azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
|---|---|
| PubChem CID | 51342034 |
| Molecular Formula | C6H4F11NO3 |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | azanium 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoate |
| SMILES | O=C([O-])C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F.[NH4+] |
| InChI | InChI=1S/C6HF11O3.H3N/c7-2(1(18)19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15;/h(H,18,19);1H3 |
| InChIKey | RJWVKMAIYPNUSL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|