C8F12K2O6 — CID 25110976
dipotassium;2-[1-(1-carboxylato-1,2,2,2-tetrafluoroethoxy)-1,2,2,2-tetrafluoroethoxy]-2,3,3,3-tetrafluoropropanoate (PubChem CID 25110976) has the molecular formula C8F12K2O6 and a molecular weight of 498.25 g/mol. Its IUPAC name is dipotassium;2-[1-(1-carboxylato-1,2,2,2-tetrafluoroethoxy)-1,2,2,2-tetrafluoroethoxy]-2,3,3,3-tetrafluoropropanoate.
| Compound Name | dipotassium;2-[1-(1-carboxylato-1,2,2,2-tetrafluoroethoxy)-1,2,2,2-tetrafluoroethoxy]-2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 25110976 |
| Molecular Formula | C8F12K2O6 |
| Molecular Weight | 498.25 g/mol |
| Exact Mass | 497.88 |
| IUPAC Name | dipotassium;2-[1-(1-carboxylato-1,2,2,2-tetrafluoroethoxy)-1,2,2,2-tetrafluoroethoxy]-2,3,3,3-tetrafluoropropanoate |
| SMILES | O=C([O-])C(F)(OC(F)(OC(F)(C(=O)[O-])C(F)(F)F)C(F)(F)F)C(F)(F)F.[K+].[K+] |
| InChI | InChI=1S/C8H2F12O6.2K/c9-3(1(21)22,5(11,12)13)25-8(20,7(17,18)19)26-4(10,2(23)24)6(14,15)16;;/h(H,21,22)(H,23,24);;/q;2*+1/p-2 |
| InChIKey | MWSBYPBJPBJURY-UHFFFAOYSA-L |
| XLogP | -5.83 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.25 |
| LogP ≤ 5 | -5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|