C4F4K2O4 — CID 154632126
dipotassium;2,2,3,3-tetrafluorobutanedioate (PubChem CID 154632126) has the molecular formula C4F4K2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is dipotassium;2,2,3,3-tetrafluorobutanedioate.
| Compound Name | dipotassium;2,2,3,3-tetrafluorobutanedioate |
|---|---|
| PubChem CID | 154632126 |
| Molecular Formula | C4F4K2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 265.90 |
| IUPAC Name | dipotassium;2,2,3,3-tetrafluorobutanedioate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C4H2F4O4.2K/c5-3(6,1(9)10)4(7,8)2(11)12;;/h(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | RLMRVOHIGMNYBS-UHFFFAOYSA-L |
| XLogP | -8.24 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | -8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|