C6CuF8O4 — CID 175584674
copper 2,2,3,3,4,4,5,5-octafluorohexanedioate (PubChem CID 175584674) has the molecular formula C6CuF8O4 and a molecular weight of 351.59 g/mol. Its IUPAC name is copper 2,2,3,3,4,4,5,5-octafluorohexanedioate.
| Compound Name | copper 2,2,3,3,4,4,5,5-octafluorohexanedioate |
|---|---|
| PubChem CID | 175584674 |
| Molecular Formula | C6CuF8O4 |
| Molecular Weight | 351.59 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | copper 2,2,3,3,4,4,5,5-octafluorohexanedioate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)[O-].[Cu+2] |
| InChI | InChI=1S/C6H2F8O4.Cu/c7-3(8,1(15)16)5(11,12)6(13,14)4(9,10)2(17)18;/h(H,15,16)(H,17,18);/q;+2/p-2 |
| InChIKey | OEFHRTUTFPORPC-UHFFFAOYSA-L |
| XLogP | -0.98 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.59 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|