C9H2F17NO2 — CID 71299621
CID 71299621 (PubChem CID 71299621) has the molecular formula C9H2F17NO2 and a molecular weight of 479.09 g/mol.
| Compound Name | CID 71299621 |
|---|---|
| PubChem CID | 71299621 |
| Molecular Formula | C9H2F17NO2 |
| Molecular Weight | 479.09 g/mol |
| Exact Mass | 478.98 |
| IUPAC Name | — |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[NH2+] |
| InChI | InChI=1S/C9HF17O2.H2N/c10-2(11,1(27)28)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26;/h(H,27,28);1H2/q;+1/p-1 |
| InChIKey | GHXSPDZEHBQXNY-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 73.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.09 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|