C14H8F23NO2 — CID 165363434
ethylazanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-icosafluoro-10-(trifluoromethyl)undecanoate (PubChem CID 165363434) has the molecular formula C14H8F23NO2 and a molecular weight of 659.18 g/mol. Its IUPAC name is ethylazanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-icosafluoro-10-(trifluoromethyl)undecanoate.
| Compound Name | ethylazanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-icosafluoro-10-(trifluoromethyl)undecanoate |
|---|---|
| PubChem CID | 165363434 |
| Molecular Formula | C14H8F23NO2 |
| Molecular Weight | 659.18 g/mol |
| Exact Mass | 659.02 |
| IUPAC Name | ethylazanium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-icosafluoro-10-(trifluoromethyl)undecanoate |
| SMILES | CC[NH3+].O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12HF23O2.C2H7N/c13-2(14,1(36)37)4(16,17)6(20,21)8(24,25)10(28,29)9(26,27)7(22,23)5(18,19)3(15,11(30,31)32)12(33,34)35;1-2-3/h(H,36,37);2-3H2,1H3 |
| InChIKey | BWXVRBNYCITZOK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|