C10H10F9KO2 — CID 175345663
potassium 2,2,3,3,4,4,5,5,6-nonafluorodecanoate (PubChem CID 175345663) has the molecular formula C10H10F9KO2 and a molecular weight of 372.27 g/mol. Its IUPAC name is potassium 2,2,3,3,4,4,5,5,6-nonafluorodecanoate.
| Compound Name | potassium 2,2,3,3,4,4,5,5,6-nonafluorodecanoate |
|---|---|
| PubChem CID | 175345663 |
| Molecular Formula | C10H10F9KO2 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | potassium 2,2,3,3,4,4,5,5,6-nonafluorodecanoate |
| SMILES | CCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(=O)[O-].[K+] |
| InChI | InChI=1S/C10H11F9O2.K/c1-2-3-4-5(11)7(12,13)9(16,17)10(18,19)8(14,15)6(20)21;/h5H,2-4H2,1H3,(H,20,21);/q;+1/p-1 |
| InChIKey | KXAMJDSOYISFTF-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|