C12H12F13LiO3S — CID 122481588
lithium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorododecane-1-sulfonate (PubChem CID 122481588) has the molecular formula C12H12F13LiO3S and a molecular weight of 490.21 g/mol. Its IUPAC name is lithium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorododecane-1-sulfonate.
| Compound Name | lithium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorododecane-1-sulfonate |
|---|---|
| PubChem CID | 122481588 |
| Molecular Formula | C12H12F13LiO3S |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | lithium 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorododecane-1-sulfonate |
| SMILES | CCCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].[Li+] |
| InChI | InChI=1S/C12H13F13O3S.Li/c1-2-3-4-5-6(13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)29(26,27)28;/h6H,2-5H2,1H3,(H,26,27,28);/q;+1/p-1 |
| InChIKey | GBGQHQYDDDRJPJ-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|