C20H27F18NO3S — CID 141492366
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,12,12,12-octadecafluorododecane-1-sulfonate;tetraethylazanium (PubChem CID 141492366) has the molecular formula C20H27F18NO3S and a molecular weight of 703.47 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,12,12,12-octadecafluorododecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,12,12,12-octadecafluorododecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 141492366 |
| Molecular Formula | C20H27F18NO3S |
| Molecular Weight | 703.47 g/mol |
| Exact Mass | 703.14 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,12,12,12-octadecafluorododecane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F |
| InChI | InChI=1S/C12H8F18O3S.C8H20N/c13-4(2-1-3-5(14,15)16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)11(27,28)12(29,30)34(31,32)33;1-5-9(6-2,7-3)8-4/h4H,1-3H2,(H,31,32,33);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | LTBJDJKJTAIBIW-UHFFFAOYSA-M |
| XLogP | 7.89 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.47 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|