C19H25F18NO3S — CID 141492292
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonate;tetraethylazanium (PubChem CID 141492292) has the molecular formula C19H25F18NO3S and a molecular weight of 689.44 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 141492292 |
| Molecular Formula | C19H25F18NO3S |
| Molecular Weight | 689.44 g/mol |
| Exact Mass | 689.13 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCC(F)(F)F |
| InChI | InChI=1S/C11H6F18O3S.C8H20N/c12-3(1-2-4(13,14)15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)33(30,31)32;1-5-9(6-2,7-3)8-4/h3H,1-2H2,(H,30,31,32);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | OYCQHERQTJGFMY-UHFFFAOYSA-M |
| XLogP | 7.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.44 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|