C14H23F10NO3S — CID 141491835
1,1,2,2,3,3,4,6,6,6-decafluorohexane-1-sulfonate;tetraethylazanium (PubChem CID 141491835) has the molecular formula C14H23F10NO3S and a molecular weight of 475.39 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,6,6,6-decafluorohexane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,6,6,6-decafluorohexane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 141491835 |
| Molecular Formula | C14H23F10NO3S |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 1,1,2,2,3,3,4,6,6,6-decafluorohexane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C8H20N.C6H4F10O3S/c1-5-9(6-2,7-3)8-4;7-2(1-3(8,9)10)4(11,12)5(13,14)6(15,16)20(17,18)19/h5-8H2,1-4H3;2H,1H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | SHVPTVWXPKZLOJ-UHFFFAOYSA-M |
| XLogP | 4.57 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|