C18H27F14NO3S — CID 141492276
1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonate;tetraethylazanium (PubChem CID 141492276) has the molecular formula C18H27F14NO3S and a molecular weight of 603.46 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 141492276 |
| Molecular Formula | C18H27F14NO3S |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F |
| InChI | InChI=1S/C10H8F14O3S.C8H20N/c11-4(2-1-3-5(12,13)14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)28(25,26)27;1-5-9(6-2,7-3)8-4/h4H,1-3H2,(H,25,26,27);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | WMUOVMHVAVKZPE-UHFFFAOYSA-M |
| XLogP | 6.62 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|