C18H30F11NO3S — CID 122481847
tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorodecane-1-sulfonate (PubChem CID 122481847) has the molecular formula C18H30F11NO3S and a molecular weight of 549.49 g/mol. Its IUPAC name is tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorodecane-1-sulfonate.
| Compound Name | tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 122481847 |
| Molecular Formula | C18H30F11NO3S |
| Molecular Weight | 549.49 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | tetraethylazanium;1,1,2,2,3,3,4,4,5,5,6-undecafluorodecane-1-sulfonate |
| SMILES | CCCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C10H11F11O3S.C8H20N/c1-2-3-4-5(11)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)25(22,23)24;1-5-9(6-2,7-3)8-4/h5H,2-4H2,1H3,(H,22,23,24);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | KRYXXDNLGSFIKL-UHFFFAOYSA-M |
| XLogP | 6.08 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|