C20H38F7NO3S — CID 122482084
1,1,2,2,3,3,4-heptafluorododecane-1-sulfonate;tetraethylazanium (PubChem CID 122482084) has the molecular formula C20H38F7NO3S and a molecular weight of 505.58 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluorododecane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4-heptafluorododecane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 122482084 |
| Molecular Formula | C20H38F7NO3S |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 1,1,2,2,3,3,4-heptafluorododecane-1-sulfonate;tetraethylazanium |
| SMILES | CCCCCCCCC(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C12H19F7O3S.C8H20N/c1-2-3-4-5-6-7-8-9(13)10(14,15)11(16,17)12(18,19)23(20,21)22;1-5-9(6-2,7-3)8-4/h9H,2-8H2,1H3,(H,20,21,22);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | AFYQWKBUVRKPTK-UHFFFAOYSA-M |
| XLogP | 6.37 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|