1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid

C9H13F7O3S — CID 122480823

IUPAC1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid
SMILESCCCCCC(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C9H13F7O3S/c1-2-3-4-5-6(10)7(11,12)8(13,14)9(15,16)20(17,18)19/h6H,2-5H2,1H3,(H,17,18,19)
InChIKeyBASVZKFFTLSTMK-UHFFFAOYSA-N
MW334.25 g/mol
LogP3.66
Rot. Bonds8

About 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid

1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid (PubChem CID 122480823) has the molecular formula C9H13F7O3S and a molecular weight of 334.25 g/mol. Its IUPAC name is 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid.

Molecular Properties

Compound Name1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid
PubChem CID122480823
Molecular FormulaC9H13F7O3S
Molecular Weight334.25 g/mol
Exact Mass334.05
IUPAC Name1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid
SMILESCCCCCC(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C9H13F7O3S/c1-2-3-4-5-6(10)7(11,12)8(13,14)9(15,16)20(17,18)19/h6H,2-5H2,1H3,(H,17,18,19)
InChIKeyBASVZKFFTLSTMK-UHFFFAOYSA-N
XLogP3.66
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.25
LogP ≤ 53.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid?
The IUPAC name of 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid (CID 122480823) is 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid.
What is the SMILES notation for 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid?
The canonical SMILES for 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid is CCCCCC(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O.
What is the InChIKey of 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid?
The InChIKey is BASVZKFFTLSTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F7O3S/c1-2-3-4-5-6(10)7(11,12)8(13,14)9(15,16)20(17,18)19/h6H,2-5H2,1H3,(H,17,18,19).
What are the key properties of 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid?
1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid has a molecular weight of 334.25 g/mol, XLogP of 3.66, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2,3,3,4-heptafluorononane-1-sulfonic acid is sourced from PubChem (CID 122480823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).