C12H15F14NO3S — CID 171922704
N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonic acid (PubChem CID 171922704) has the molecular formula C12H15F14NO3S and a molecular weight of 519.30 g/mol. Its IUPAC name is N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonic acid.
| Compound Name | N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922704 |
| Molecular Formula | C12H15F14NO3S |
| Molecular Weight | 519.30 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,10,10,10-tetradecafluorodecane-1-sulfonic acid |
| SMILES | CNC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F |
| InChI | InChI=1S/C10H8F14O3S.C2H7N/c11-4(2-1-3-5(12,13)14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)28(25,26)27;1-3-2/h4H,1-3H2,(H,25,26,27);3H,1-2H3 |
| InChIKey | QYSJMMBFESTDHY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|