C11H9F18NO3S — CID 175157637
azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonic acid (PubChem CID 175157637) has the molecular formula C11H9F18NO3S and a molecular weight of 577.23 g/mol. Its IUPAC name is azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonic acid.
| Compound Name | azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonic acid |
|---|---|
| PubChem CID | 175157637 |
| Molecular Formula | C11H9F18NO3S |
| Molecular Weight | 577.23 g/mol |
| Exact Mass | 577.00 |
| IUPAC Name | azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,11,11,11-octadecafluoroundecane-1-sulfonic acid |
| SMILES | N.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCC(F)(F)F |
| InChI | InChI=1S/C11H6F18O3S.H3N/c12-3(1-2-4(13,14)15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)11(28,29)33(30,31)32;/h3H,1-2H2,(H,30,31,32);1H3 |
| InChIKey | ANJPUCOLCNMEOE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.23 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|