C8H7F11O3S — CID 122480896
1,1,2,2,3,3,4,4,5,5,6-undecafluorooctane-1-sulfonic acid (PubChem CID 122480896) has the molecular formula C8H7F11O3S and a molecular weight of 392.19 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluorooctane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluorooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 122480896 |
| Molecular Formula | C8H7F11O3S |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluorooctane-1-sulfonic acid |
| SMILES | CCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H7F11O3S/c1-2-3(9)4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)23(20,21)22/h3H,2H2,1H3,(H,20,21,22) |
| InChIKey | KKVKYSBASHELSW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|