C12H17F12NO3S — CID 175157494
azane;1,1,2,2,3,3,4,4,5,12,12,12-dodecafluorododecane-1-sulfonic acid (PubChem CID 175157494) has the molecular formula C12H17F12NO3S and a molecular weight of 483.32 g/mol. Its IUPAC name is azane;1,1,2,2,3,3,4,4,5,12,12,12-dodecafluorododecane-1-sulfonic acid.
| Compound Name | azane;1,1,2,2,3,3,4,4,5,12,12,12-dodecafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 175157494 |
| Molecular Formula | C12H17F12NO3S |
| Molecular Weight | 483.32 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | azane;1,1,2,2,3,3,4,4,5,12,12,12-dodecafluorododecane-1-sulfonic acid |
| SMILES | N.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCCCCC(F)(F)F |
| InChI | InChI=1S/C12H14F12O3S.H3N/c13-7(5-3-1-2-4-6-8(14,15)16)9(17,18)10(19,20)11(21,22)12(23,24)28(25,26)27;/h7H,1-6H2,(H,25,26,27);1H3 |
| InChIKey | GMVFGJCAKBKFCA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|