C14H25F8NO3S — CID 171922644
N-methylmethanamine;1,1,2,2,3,12,12,12-octafluorododecane-1-sulfonic acid (PubChem CID 171922644) has the molecular formula C14H25F8NO3S and a molecular weight of 439.41 g/mol. Its IUPAC name is N-methylmethanamine;1,1,2,2,3,12,12,12-octafluorododecane-1-sulfonic acid.
| Compound Name | N-methylmethanamine;1,1,2,2,3,12,12,12-octafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922644 |
| Molecular Formula | C14H25F8NO3S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | N-methylmethanamine;1,1,2,2,3,12,12,12-octafluorododecane-1-sulfonic acid |
| SMILES | CNC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)CCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C12H18F8O3S.C2H7N/c13-9(11(17,18)12(19,20)24(21,22)23)7-5-3-1-2-4-6-8-10(14,15)16;1-3-2/h9H,1-8H2,(H,21,22,23);3H,1-2H3 |
| InChIKey | CLHNTWHEIPHWJT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|