C9H11F8LiO3S — CID 141492125
lithium 1,1,2,2,3,9,9,9-octafluorononane-1-sulfonate (PubChem CID 141492125) has the molecular formula C9H11F8LiO3S and a molecular weight of 358.18 g/mol. Its IUPAC name is lithium 1,1,2,2,3,9,9,9-octafluorononane-1-sulfonate.
| Compound Name | lithium 1,1,2,2,3,9,9,9-octafluorononane-1-sulfonate |
|---|---|
| PubChem CID | 141492125 |
| Molecular Formula | C9H11F8LiO3S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | lithium 1,1,2,2,3,9,9,9-octafluorononane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)CCCCCC(F)(F)F.[Li+] |
| InChI | InChI=1S/C9H12F8O3S.Li/c10-6(4-2-1-3-5-7(11,12)13)8(14,15)9(16,17)21(18,19)20;/h6H,1-5H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | BIKDELDDLQLTBS-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|