C8H13F4KO3S — CID 141491902
potassium 1,8,8,8-tetrafluorooctane-1-sulfonate (PubChem CID 141491902) has the molecular formula C8H13F4KO3S and a molecular weight of 304.35 g/mol. Its IUPAC name is potassium 1,8,8,8-tetrafluorooctane-1-sulfonate.
| Compound Name | potassium 1,8,8,8-tetrafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 141491902 |
| Molecular Formula | C8H13F4KO3S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | potassium 1,8,8,8-tetrafluorooctane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)CCCCCCC(F)(F)F.[K+] |
| InChI | InChI=1S/C8H14F4O3S.K/c9-7(16(13,14)15)5-3-1-2-4-6-8(10,11)12;/h7H,1-6H2,(H,13,14,15);/q;+1/p-1 |
| InChIKey | KTZYZHAQQIIMAX-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|