C7H15F4NO3S — CID 141492076
dimethylazanium;1,5,5,5-tetrafluoropentane-1-sulfonate (PubChem CID 141492076) has the molecular formula C7H15F4NO3S and a molecular weight of 269.26 g/mol. Its IUPAC name is dimethylazanium;1,5,5,5-tetrafluoropentane-1-sulfonate.
| Compound Name | dimethylazanium;1,5,5,5-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 141492076 |
| Molecular Formula | C7H15F4NO3S |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | dimethylazanium;1,5,5,5-tetrafluoropentane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])C(F)CCCC(F)(F)F |
| InChI | InChI=1S/C5H8F4O3S.C2H7N/c6-4(13(10,11)12)2-1-3-5(7,8)9;1-3-2/h4H,1-3H2,(H,10,11,12);3H,1-2H3 |
| InChIKey | CGEJCWSNMWVTMD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|