C7H12F4O3S — CID 141491980
1,7,7,7-tetrafluoroheptane-1-sulfonic acid (PubChem CID 141491980) has the molecular formula C7H12F4O3S and a molecular weight of 252.23 g/mol. Its IUPAC name is 1,7,7,7-tetrafluoroheptane-1-sulfonic acid.
| Compound Name | 1,7,7,7-tetrafluoroheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 141491980 |
| Molecular Formula | C7H12F4O3S |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1,7,7,7-tetrafluoroheptane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C7H12F4O3S/c8-6(15(12,13)14)4-2-1-3-5-7(9,10)11/h6H,1-5H2,(H,12,13,14) |
| InChIKey | LUSSBCSTTGFAJV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|