C5H11F4NO3S — CID 141492353
azanium 1,5,5,5-tetrafluoropentane-1-sulfonate (PubChem CID 141492353) has the molecular formula C5H11F4NO3S and a molecular weight of 241.21 g/mol. Its IUPAC name is azanium 1,5,5,5-tetrafluoropentane-1-sulfonate.
| Compound Name | azanium 1,5,5,5-tetrafluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 141492353 |
| Molecular Formula | C5H11F4NO3S |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | azanium 1,5,5,5-tetrafluoropentane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)CCCC(F)(F)F.[NH4+] |
| InChI | InChI=1S/C5H8F4O3S.H3N/c6-4(13(10,11)12)2-1-3-5(7,8)9;/h4H,1-3H2,(H,10,11,12);1H3 |
| InChIKey | RHTFKGCLPBULSU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|