C4H8CsFO3S — CID 141058124
cesium 1-fluorobutane-1-sulfonate (PubChem CID 141058124) has the molecular formula C4H8CsFO3S and a molecular weight of 288.08 g/mol. Its IUPAC name is cesium 1-fluorobutane-1-sulfonate.
| Compound Name | cesium 1-fluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141058124 |
| Molecular Formula | C4H8CsFO3S |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | cesium 1-fluorobutane-1-sulfonate |
| SMILES | CCCC(F)S(=O)(=O)[O-].[Cs+] |
| InChI | InChI=1S/C4H9FO3S.Cs/c1-2-3-4(5)9(6,7)8;/h4H,2-3H2,1H3,(H,6,7,8);/q;+1/p-1 |
| InChIKey | UCEAWDCDNLKYLY-UHFFFAOYSA-M |
| XLogP | -2.37 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|