C14H24FNO3S — CID 141043199
benzyl(trimethyl)azanium;1-fluorobutane-1-sulfonate (PubChem CID 141043199) has the molecular formula C14H24FNO3S and a molecular weight of 305.42 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;1-fluorobutane-1-sulfonate.
| Compound Name | benzyl(trimethyl)azanium;1-fluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 141043199 |
| Molecular Formula | C14H24FNO3S |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | benzyl(trimethyl)azanium;1-fluorobutane-1-sulfonate |
| SMILES | CCCC(F)S(=O)(=O)[O-].C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N.C4H9FO3S/c1-11(2,3)9-10-7-5-4-6-8-10;1-2-3-4(5)9(6,7)8/h4-8H,9H2,1-3H3;4H,2-3H2,1H3,(H,6,7,8)/q+1;/p-1 |
| InChIKey | DLVQTWXQAXWNHK-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|