About benzyl(trimethyl)azanium;ethoxyethane
benzyl(trimethyl)azanium;ethoxyethane (PubChem CID 88793118) has the molecular formula C14H26NO+
and a molecular weight of 224.37 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;ethoxyethane.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;ethoxyethane |
| PubChem CID | 88793118 |
| Molecular Formula | C14H26NO+ |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | benzyl(trimethyl)azanium;ethoxyethane |
| SMILES | CCOCC.C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N.C4H10O/c1-11(2,3)9-10-7-5-4-6-8-10;1-3-5-4-2/h4-8H,9H2,1-3H3;3-4H2,1-2H3/q+1; |
| InChIKey | CEVIQCXPJYHWJP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;ethoxyethane?
The IUPAC name of benzyl(trimethyl)azanium;ethoxyethane (CID 88793118) is benzyl(trimethyl)azanium;ethoxyethane.
What is the SMILES notation for benzyl(trimethyl)azanium;ethoxyethane?
The canonical SMILES for benzyl(trimethyl)azanium;ethoxyethane is CCOCC.C[N+](C)(C)Cc1ccccc1.
What is the InChIKey of benzyl(trimethyl)azanium;ethoxyethane?
The InChIKey is CEVIQCXPJYHWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N.C4H10O/c1-11(2,3)9-10-7-5-4-6-8-10;1-3-5-4-2/h4-8H,9H2,1-3H3;3-4H2,1-2H3/q+1;.
What are the key properties of benzyl(trimethyl)azanium;ethoxyethane?
benzyl(trimethyl)azanium;ethoxyethane has a molecular weight of 224.37 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;ethoxyethane is sourced from PubChem (CID 88793118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).