About benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide
benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide (PubChem CID 87100014) has the molecular formula C13H25AlClN
and a molecular weight of 257.79 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide.
Molecular Properties
| Compound Name | benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide |
| PubChem CID | 87100014 |
| Molecular Formula | C13H25AlClN |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide |
| SMILES | C[Al-](C)(C)Cl.C[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N.3CH3.Al.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;;;;;/h4-8H,9H2,1-3H3;3*1H3;;1H/q+1;;;;;/p-1 |
| InChIKey | MLDXNTIFILDFLT-UHFFFAOYSA-M |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide?
The IUPAC name of benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide (CID 87100014) is benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide.
What is the SMILES notation for benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide?
The canonical SMILES for benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide is C[Al-](C)(C)Cl.C[N+](C)(C)Cc1ccccc1.
What is the InChIKey of benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide?
The InChIKey is MLDXNTIFILDFLT-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N.3CH3.Al.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;;;;;/h4-8H,9H2,1-3H3;3*1H3;;1H/q+1;;;;;/p-1.
What are the key properties of benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide?
benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide has a molecular weight of 257.79 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(trimethyl)azanium;chloro(trimethyl)alumanuide is sourced from PubChem (CID 87100014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).