About bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane
bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane (PubChem CID 142675519) has the molecular formula C20H34N2O4Si
and a molecular weight of 394.59 g/mol. Its IUPAC name is bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane.
Molecular Properties
| Compound Name | bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane |
| PubChem CID | 142675519 |
| Molecular Formula | C20H34N2O4Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane |
| SMILES | C[N+](C)(C)Cc1ccccc1.C[N+](C)(C)Cc1ccccc1.[O-][Si]([O-])(O)O |
| InChI | InChI=1S/2C10H16N.H2O4Si/c2*1-11(2,3)9-10-7-5-4-6-8-10;1-5(2,3)4/h2*4-8H,9H2,1-3H3;1-2H/q2*+1;-2 |
| InChIKey | KHIZBEOHVHDZOK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane?
The IUPAC name of bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane (CID 142675519) is bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane.
What is the SMILES notation for bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane?
The canonical SMILES for bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane is C[N+](C)(C)Cc1ccccc1.C[N+](C)(C)Cc1ccccc1.[O-][Si]([O-])(O)O.
What is the InChIKey of bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane?
The InChIKey is KHIZBEOHVHDZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H16N.H2O4Si/c2*1-11(2,3)9-10-7-5-4-6-8-10;1-5(2,3)4/h2*4-8H,9H2,1-3H3;1-2H/q2*+1;-2.
What are the key properties of bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane?
bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane has a molecular weight of 394.59 g/mol, XLogP of -0.09, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzyl(trimethyl)azanium);dihydroxy(dioxido)silane is sourced from PubChem (CID 142675519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).