C16H16F13NO3S — CID 139914348
benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (PubChem CID 139914348) has the molecular formula C16H16F13NO3S and a molecular weight of 549.35 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate.
| Compound Name | benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 139914348 |
| Molecular Formula | C16H16F13NO3S |
| Molecular Weight | 549.35 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16N.C6HF13O3S/c1-11(2,3)9-10-7-5-4-6-8-10;7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h4-8H,9H2,1-3H3;(H,20,21,22)/q+1;/p-1 |
| InChIKey | KRDSKLZPHCVEJS-UHFFFAOYSA-M |
| XLogP | 5.12 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.35 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|