C14H17F9NO3S+ — CID 86588803
benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 86588803) has the molecular formula C14H17F9NO3S+ and a molecular weight of 450.34 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 86588803 |
| Molecular Formula | C14H17F9NO3S+ |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | benzyl(trimethyl)azanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H16N.C4HF9O3S/c1-11(2,3)9-10-7-5-4-6-8-10;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-8H,9H2,1-3H3;(H,14,15,16)/q+1; |
| InChIKey | IFZRELRVNCBWLC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|