C23H18F9NO5S2 — CID 171922646
4-methylsulfonyl-N,N-diphenylaniline;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 171922646) has the molecular formula C23H18F9NO5S2 and a molecular weight of 623.52 g/mol. Its IUPAC name is 4-methylsulfonyl-N,N-diphenylaniline;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 4-methylsulfonyl-N,N-diphenylaniline;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922646 |
| Molecular Formula | C23H18F9NO5S2 |
| Molecular Weight | 623.52 g/mol |
| Exact Mass | 623.05 |
| IUPAC Name | 4-methylsulfonyl-N,N-diphenylaniline;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | CS(=O)(=O)c1ccc(N(c2ccccc2)c2ccccc2)cc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H17NO2S.C4HF9O3S/c1-23(21,22)19-14-12-18(13-15-19)20(16-8-4-2-5-9-16)17-10-6-3-7-11-17;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h2-15H,1H3;(H,14,15,16) |
| InChIKey | KYRTWHDOYZFPOG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|