C13H15F9NO3S+ — CID 87848212
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trimethyl(phenyl)azanium (PubChem CID 87848212) has the molecular formula C13H15F9NO3S+ and a molecular weight of 436.32 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trimethyl(phenyl)azanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trimethyl(phenyl)azanium |
|---|---|
| PubChem CID | 87848212 |
| Molecular Formula | C13H15F9NO3S+ |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;trimethyl(phenyl)azanium |
| SMILES | C[N+](C)(C)c1ccccc1.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14N.C4HF9O3S/c1-10(2,3)9-7-5-4-6-8-9;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-8H,1-3H3;(H,14,15,16)/q+1; |
| InChIKey | LBIMAHXOZRJRLW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|