C9H6F9NO3S — CID 171925066
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;pyridine (PubChem CID 171925066) has the molecular formula C9H6F9NO3S and a molecular weight of 379.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;pyridine.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;pyridine |
|---|---|
| PubChem CID | 171925066 |
| Molecular Formula | C9H6F9NO3S |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid;pyridine |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4HF9O3S/c1-2-4-6-5-3-1;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-5H;(H,14,15,16) |
| InChIKey | JSRHBBHTTASSTP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|