C13H10F13NO3S — CID 171922755
pyridine;1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctane-1-sulfonic acid (PubChem CID 171922755) has the molecular formula C13H10F13NO3S and a molecular weight of 507.27 g/mol. Its IUPAC name is pyridine;1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctane-1-sulfonic acid.
| Compound Name | pyridine;1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922755 |
| Molecular Formula | C13H10F13NO3S |
| Molecular Weight | 507.27 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | pyridine;1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C8H5F13O3S.C5H5N/c9-3(10,1-2-4(11,12)13)5(14,15)6(16,17)7(18,19)8(20,21)25(22,23)24;1-2-4-6-5-3-1/h1-2H2,(H,22,23,24);1-5H |
| InChIKey | LIJDVBPBEIVNEQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.27 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|