C16H20F9NO3S — CID 171922572
1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonic acid;pyridine (PubChem CID 171922572) has the molecular formula C16H20F9NO3S and a molecular weight of 477.39 g/mol. Its IUPAC name is 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonic acid;pyridine.
| Compound Name | 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonic acid;pyridine |
|---|---|
| PubChem CID | 171922572 |
| Molecular Formula | C16H20F9NO3S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1,1,2,2,3,3,11,11,11-nonafluoroundecane-1-sulfonic acid;pyridine |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)CCCCCCCC(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C11H15F9O3S.C5H5N/c12-8(13,10(17,18)11(19,20)24(21,22)23)6-4-2-1-3-5-7-9(14,15)16;1-2-4-6-5-3-1/h1-7H2,(H,21,22,23);1-5H |
| InChIKey | YOCULDVKZICOLR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|