C15H14F13NO3S — CID 171922635
pyridine;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonic acid (PubChem CID 171922635) has the molecular formula C15H14F13NO3S and a molecular weight of 535.32 g/mol. Its IUPAC name is pyridine;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonic acid.
| Compound Name | pyridine;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922635 |
| Molecular Formula | C15H14F13NO3S |
| Molecular Weight | 535.32 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | pyridine;1,1,2,2,3,3,4,4,5,5,10,10,10-tridecafluorodecane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C10H9F13O3S.C5H5N/c11-5(12,3-1-2-4-6(13,14)15)7(16,17)8(18,19)9(20,21)10(22,23)27(24,25)26;1-2-4-6-5-3-1/h1-4H2,(H,24,25,26);1-5H |
| InChIKey | QELXFHQSUMNDDG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.32 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|