C17H18F13NO3S — CID 171922925
pyridine;1,1,2,2,3,3,4,4,5,5,12,12,12-tridecafluorododecane-1-sulfonic acid (PubChem CID 171922925) has the molecular formula C17H18F13NO3S and a molecular weight of 563.38 g/mol. Its IUPAC name is pyridine;1,1,2,2,3,3,4,4,5,5,12,12,12-tridecafluorododecane-1-sulfonic acid.
| Compound Name | pyridine;1,1,2,2,3,3,4,4,5,5,12,12,12-tridecafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922925 |
| Molecular Formula | C17H18F13NO3S |
| Molecular Weight | 563.38 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | pyridine;1,1,2,2,3,3,4,4,5,5,12,12,12-tridecafluorododecane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCCCC(F)(F)F.c1ccncc1 |
| InChI | InChI=1S/C12H13F13O3S.C5H5N/c13-7(14,5-3-1-2-4-6-8(15,16)17)9(18,19)10(20,21)11(22,23)12(24,25)29(26,27)28;1-2-4-6-5-3-1/h1-6H2,(H,26,27,28);1-5H |
| InChIKey | QHADQGYLRRXGDQ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.38 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|