C12H12F17NO3S — CID 175161760
azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecane-1-sulfonic acid (PubChem CID 175161760) has the molecular formula C12H12F17NO3S and a molecular weight of 573.26 g/mol. Its IUPAC name is azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecane-1-sulfonic acid.
| Compound Name | azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 175161760 |
| Molecular Formula | C12H12F17NO3S |
| Molecular Weight | 573.26 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | azane;1,1,2,2,3,3,4,4,5,5,6,6,7,7,12,12,12-heptadecafluorododecane-1-sulfonic acid |
| SMILES | N.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C12H9F17O3S.H3N/c13-5(14,3-1-2-4-6(15,16)17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)33(30,31)32;/h1-4H2,(H,30,31,32);1H3 |
| InChIKey | QZCQMZCRNHOMJH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.26 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|