C6H6F11NO3S — CID 175529601
azane;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid (PubChem CID 175529601) has the molecular formula C6H6F11NO3S and a molecular weight of 381.16 g/mol. Its IUPAC name is azane;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid.
| Compound Name | azane;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 175529601 |
| Molecular Formula | C6H6F11NO3S |
| Molecular Weight | 381.16 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | azane;1,1,2,2,3,3,4,4,6,6,6-undecafluorohexane-1-sulfonic acid |
| SMILES | N.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C6H3F11O3S.H3N/c7-2(8,1-3(9,10)11)4(12,13)5(14,15)6(16,17)21(18,19)20;/h1H2,(H,18,19,20);1H3 |
| InChIKey | GJCQTNRHXNXJKP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|